C38H63N2O3+ — CID 89243892
[(1R,4R,5R,13R,19R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-yl] 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)acetate (PubChem CID 89243892) has the molecular formula C38H63N2O3+ and a molecular weight of 595.93 g/mol. Its IUPAC name is [(1R,4R,5R,13R,19R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-yl] 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)acetate.
| Compound Name | [(1R,4R,5R,13R,19R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-yl] 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)acetate |
|---|---|
| PubChem CID | 89243892 |
| Molecular Formula | C38H63N2O3+ |
| Molecular Weight | 595.93 g/mol |
| Exact Mass | 595.48 |
| IUPAC Name | [(1R,4R,5R,13R,19R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-yl] 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)acetate |
| SMILES | CC1(C)C(OC(=O)C[N+]23CCN(CC2)CC3)CC[C@@]2(C)C1CC[C@]1(C)C2CCC2C3[C@H]4OC[C@@]3(CCC4(C)C)CC[C@]21C |
| InChI | InChI=1S/C38H63N2O3/c1-33(2)14-16-38-17-15-36(6)26(31(38)32(33)42-25-38)8-9-28-35(5)12-11-29(34(3,4)27(35)10-13-37(28,36)7)43-30(41)24-40-21-18-39(19-22-40)20-23-40/h26-29,31-32H,8-25H2,1-7H3/q+1/t26?,27?,28?,29?,31?,32-,35+,36-,37-,38-/m1/s1 |
| InChIKey | HYJGVLJBEABYFL-YSJCVANVSA-N |
| XLogP | 6.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.93 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|