C42H74NO3+ — CID 89243899
[2-[[(1R,4R,5R,10S,13R,19R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-yl]oxy]-2-oxoethyl]-dimethyl-octylazanium (PubChem CID 89243899) has the molecular formula C42H74NO3+ and a molecular weight of 641.06 g/mol. Its IUPAC name is [2-[[(1R,4R,5R,10S,13R,19R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-yl]oxy]-2-oxoethyl]-dimethyl-octylazanium.
| Compound Name | [2-[[(1R,4R,5R,10S,13R,19R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-yl]oxy]-2-oxoethyl]-dimethyl-octylazanium |
|---|---|
| PubChem CID | 89243899 |
| Molecular Formula | C42H74NO3+ |
| Molecular Weight | 641.06 g/mol |
| Exact Mass | 640.57 |
| IUPAC Name | [2-[[(1R,4R,5R,10S,13R,19R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-yl]oxy]-2-oxoethyl]-dimethyl-octylazanium |
| SMILES | CCCCCCCC[N+](C)(C)CC(=O)O[C@H]1CC[C@@]2(C)C(CC[C@]3(C)C2CCC2C4[C@H]5OC[C@@]4(CCC5(C)C)CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C42H74NO3/c1-11-12-13-14-15-16-27-43(9,10)28-34(44)46-33-20-21-39(6)31(38(33,4)5)19-22-41(8)32(39)18-17-30-35-36-37(2,3)23-25-42(35,29-45-36)26-24-40(30,41)7/h30-33,35-36H,11-29H2,1-10H3/q+1/t30?,31?,32?,33-,35?,36+,39-,40+,41+,42+/m0/s1 |
| InChIKey | PTNVOQRNLPYBTP-UTWMTRFYSA-N |
| XLogP | 10.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.06 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|