C9H11NO — CID 142269992
(E,1Z)-1-(2-methylidene-1H-pyrrol-3-ylidene)but-2-en-2-ol (PubChem CID 142269992) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is (E,1Z)-1-(2-methylidene-1H-pyrrol-3-ylidene)but-2-en-2-ol.
| Compound Name | (E,1Z)-1-(2-methylidene-1H-pyrrol-3-ylidene)but-2-en-2-ol |
|---|---|
| PubChem CID | 142269992 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | (E,1Z)-1-(2-methylidene-1H-pyrrol-3-ylidene)but-2-en-2-ol |
| SMILES | C=c1[nH]cc/c1=C/C(O)=C\C |
| InChI | InChI=1S/C9H11NO/c1-3-9(11)6-8-4-5-10-7(8)2/h3-6,10-11H,2H2,1H3/b8-6-,9-3+ |
| InChIKey | UXWNXPSEAHEBGZ-FTYJLKAESA-N |
| XLogP | 0.67 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|