C17H30O2 — CID 142270233
ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]oxolan-3-one (PubChem CID 142270233) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]oxolan-3-one.
| Compound Name | ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]oxolan-3-one |
|---|---|
| PubChem CID | 142270233 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | ethane;2-methyl-5-[(2E,6E)-6-methylnona-2,6-dien-2-yl]oxolan-3-one |
| SMILES | CC.CC/C=C(\C)CC/C=C(\C)C1CC(=O)C(C)O1 |
| InChI | InChI=1S/C15H24O2.C2H6/c1-5-7-11(2)8-6-9-12(3)15-10-14(16)13(4)17-15;1-2/h7,9,13,15H,5-6,8,10H2,1-4H3;1-2H3/b11-7+,12-9+; |
| InChIKey | JBZWNBFJHHASAT-TZSSSIPKSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|