C18H28O5 — CID 54210301
2-(8-methoxy-7-oxooct-2-enyl)-4-(2-methoxypropan-2-yloxy)cyclopent-2-en-1-one (PubChem CID 54210301) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-(8-methoxy-7-oxooct-2-enyl)-4-(2-methoxypropan-2-yloxy)cyclopent-2-en-1-one.
| Compound Name | 2-(8-methoxy-7-oxooct-2-enyl)-4-(2-methoxypropan-2-yloxy)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 54210301 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 2-(8-methoxy-7-oxooct-2-enyl)-4-(2-methoxypropan-2-yloxy)cyclopent-2-en-1-one |
| SMILES | COCC(=O)CCCC=CCC1=CC(OC(C)(C)OC)CC1=O |
| InChI | InChI=1S/C18H28O5/c1-18(2,22-4)23-16-11-14(17(20)12-16)9-7-5-6-8-10-15(19)13-21-3/h5,7,11,16H,6,8-10,12-13H2,1-4H3 |
| InChIKey | PVMNDRQSJGNCQU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|