C15H26O2 — CID 142271065
butane;4-ethyl-5-propan-2-ylbenzene-1,2-diol (PubChem CID 142271065) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is butane;4-ethyl-5-propan-2-ylbenzene-1,2-diol.
| Compound Name | butane;4-ethyl-5-propan-2-ylbenzene-1,2-diol |
|---|---|
| PubChem CID | 142271065 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | butane;4-ethyl-5-propan-2-ylbenzene-1,2-diol |
| SMILES | CCCC.CCc1cc(O)c(O)cc1C(C)C |
| InChI | InChI=1S/C11H16O2.C4H10/c1-4-8-5-10(12)11(13)6-9(8)7(2)3;1-3-4-2/h5-7,12-13H,4H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | YHZBXHJTALSYDR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|