C22H24Cl2N4O2 — CID 142272667
4-amino-2-[(4-cyanophenyl)methyl]-N-[(1E,3E,5E)-3,5-dichlorohepta-1,3,5-trienyl]-1-formyl-N-methylpyrrolidine-2-carboxamide (PubChem CID 142272667) has the molecular formula C22H24Cl2N4O2 and a molecular weight of 447.37 g/mol. Its IUPAC name is 4-amino-2-[(4-cyanophenyl)methyl]-N-[(1E,3E,5E)-3,5-dichlorohepta-1,3,5-trienyl]-1-formyl-N-methylpyrrolidine-2-carboxamide.
| Compound Name | 4-amino-2-[(4-cyanophenyl)methyl]-N-[(1E,3E,5E)-3,5-dichlorohepta-1,3,5-trienyl]-1-formyl-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 142272667 |
| Molecular Formula | C22H24Cl2N4O2 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 4-amino-2-[(4-cyanophenyl)methyl]-N-[(1E,3E,5E)-3,5-dichlorohepta-1,3,5-trienyl]-1-formyl-N-methylpyrrolidine-2-carboxamide |
| SMILES | C/C=C(Cl)\C=C(Cl)/C=C/N(C)C(=O)C1(Cc2ccc(C#N)cc2)CC(N)CN1C=O |
| InChI | InChI=1S/C22H24Cl2N4O2/c1-3-18(23)10-19(24)8-9-27(2)21(30)22(12-20(26)14-28(22)15-29)11-16-4-6-17(13-25)7-5-16/h3-10,15,20H,11-12,14,26H2,1-2H3/b9-8+,18-3+,19-10+ |
| InChIKey | FCQKJCBOSMBFGI-RJTJCUSNSA-N |
| XLogP | 3.27 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|