C18H19N5O4 — CID 140530826
2-O-methyl 1-O-prop-2-enyl (2S,4R)-4-azido-2-[(4-cyanophenyl)methyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 140530826) has the molecular formula C18H19N5O4 and a molecular weight of 369.38 g/mol. Its IUPAC name is 2-O-methyl 1-O-prop-2-enyl (2S,4R)-4-azido-2-[(4-cyanophenyl)methyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-methyl 1-O-prop-2-enyl (2S,4R)-4-azido-2-[(4-cyanophenyl)methyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 140530826 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 2-O-methyl 1-O-prop-2-enyl (2S,4R)-4-azido-2-[(4-cyanophenyl)methyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](N=[N+]=[N-])C[C@@]1(Cc1ccc(C#N)cc1)C(=O)OC |
| InChI | InChI=1S/C18H19N5O4/c1-3-8-27-17(25)23-12-15(21-22-20)10-18(23,16(24)26-2)9-13-4-6-14(11-19)7-5-13/h3-7,15H,1,8-10,12H2,2H3/t15-,18+/m1/s1 |
| InChIKey | XIGQVIZVGMBNNQ-QAPCUYQASA-N |
| XLogP | 2.72 |
| TPSA | 128.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|