C13H19N — CID 142275876
4-(1-bicyclo[4.1.0]hepta-2,4-dienylmethyl)piperidine (PubChem CID 142275876) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 4-(1-bicyclo[4.1.0]hepta-2,4-dienylmethyl)piperidine.
| Compound Name | 4-(1-bicyclo[4.1.0]hepta-2,4-dienylmethyl)piperidine |
|---|---|
| PubChem CID | 142275876 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 4-(1-bicyclo[4.1.0]hepta-2,4-dienylmethyl)piperidine |
| SMILES | C1=CC2CC2(CC2CCNCC2)C=C1 |
| InChI | InChI=1S/C13H19N/c1-2-6-13(10-12(13)3-1)9-11-4-7-14-8-5-11/h1-3,6,11-12,14H,4-5,7-10H2 |
| InChIKey | VCPIQMRVGRRJKA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |