C22H16ClFN2O2S — CID 142277657
[3-amino-6-[3-(methylsulfanylamino)phenyl]-1-benzofuran-2-yl]-(2-chloro-4-fluorophenyl)methanone (PubChem CID 142277657) has the molecular formula C22H16ClFN2O2S and a molecular weight of 426.90 g/mol. Its IUPAC name is [3-amino-6-[3-(methylsulfanylamino)phenyl]-1-benzofuran-2-yl]-(2-chloro-4-fluorophenyl)methanone.
| Compound Name | [3-amino-6-[3-(methylsulfanylamino)phenyl]-1-benzofuran-2-yl]-(2-chloro-4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 142277657 |
| Molecular Formula | C22H16ClFN2O2S |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | [3-amino-6-[3-(methylsulfanylamino)phenyl]-1-benzofuran-2-yl]-(2-chloro-4-fluorophenyl)methanone |
| SMILES | CSNc1cccc(-c2ccc3c(N)c(C(=O)c4ccc(F)cc4Cl)oc3c2)c1 |
| InChI | InChI=1S/C22H16ClFN2O2S/c1-29-26-15-4-2-3-12(9-15)13-5-7-17-19(10-13)28-22(20(17)25)21(27)16-8-6-14(24)11-18(16)23/h2-11,26H,25H2,1H3 |
| InChIKey | GVEGSUUXPZWTMK-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|