C20H19ClN4O2S — CID 142277705
N-[(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-10-yl)-(3-methylimidazol-4-yl)methyl]methanesulfonamide (PubChem CID 142277705) has the molecular formula C20H19ClN4O2S and a molecular weight of 414.92 g/mol. Its IUPAC name is N-[(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-10-yl)-(3-methylimidazol-4-yl)methyl]methanesulfonamide.
| Compound Name | N-[(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-10-yl)-(3-methylimidazol-4-yl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 142277705 |
| Molecular Formula | C20H19ClN4O2S |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | N-[(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-10-yl)-(3-methylimidazol-4-yl)methyl]methanesulfonamide |
| SMILES | Cn1cncc1C(NS(C)(=O)=O)C1=Cc2cccnc2Cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C20H19ClN4O2S/c1-25-12-22-11-19(25)20(24-28(2,26)27)17-8-14-4-3-7-23-18(14)9-13-5-6-15(21)10-16(13)17/h3-8,10-12,20,24H,9H2,1-2H3 |
| InChIKey | HIGJDZZWFXPQAF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |