C16H14ClN — CID 142278223
13-chloro-10-ethyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene (PubChem CID 142278223) has the molecular formula C16H14ClN and a molecular weight of 255.75 g/mol. Its IUPAC name is 13-chloro-10-ethyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene.
| Compound Name | 13-chloro-10-ethyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
|---|---|
| PubChem CID | 142278223 |
| Molecular Formula | C16H14ClN |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 13-chloro-10-ethyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
| SMILES | CCC1=Cc2cccnc2Cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H14ClN/c1-2-11-8-13-4-3-7-18-16(13)9-12-5-6-14(17)10-15(11)12/h3-8,10H,2,9H2,1H3 |
| InChIKey | ZAFQOFBHNCDISH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |