C22H21ClN2O2 — CID 142278489
methyl 3-[5-(3-chlorophenyl)quinazolin-4-yl]cyclohexane-1-carboxylate (PubChem CID 142278489) has the molecular formula C22H21ClN2O2 and a molecular weight of 380.88 g/mol. Its IUPAC name is methyl 3-[5-(3-chlorophenyl)quinazolin-4-yl]cyclohexane-1-carboxylate.
| Compound Name | methyl 3-[5-(3-chlorophenyl)quinazolin-4-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 142278489 |
| Molecular Formula | C22H21ClN2O2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | methyl 3-[5-(3-chlorophenyl)quinazolin-4-yl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCCC(c2ncnc3cccc(-c4cccc(Cl)c4)c23)C1 |
| InChI | InChI=1S/C22H21ClN2O2/c1-27-22(26)16-7-2-6-15(11-16)21-20-18(14-5-3-8-17(23)12-14)9-4-10-19(20)24-13-25-21/h3-5,8-10,12-13,15-16H,2,6-7,11H2,1H3 |
| InChIKey | FEABBYQLELBXBC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |