C25H27FN2O2 — CID 142279830
4-(3-fluoro-2-methoxyphenyl)-N-[(4-phenylcyclohexyl)methyl]-1H-pyrrole-3-carboxamide (PubChem CID 142279830) has the molecular formula C25H27FN2O2 and a molecular weight of 406.50 g/mol. Its IUPAC name is 4-(3-fluoro-2-methoxyphenyl)-N-[(4-phenylcyclohexyl)methyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 4-(3-fluoro-2-methoxyphenyl)-N-[(4-phenylcyclohexyl)methyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 142279830 |
| Molecular Formula | C25H27FN2O2 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 4-(3-fluoro-2-methoxyphenyl)-N-[(4-phenylcyclohexyl)methyl]-1H-pyrrole-3-carboxamide |
| SMILES | COc1c(F)cccc1-c1c[nH]cc1C(=O)NCC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H27FN2O2/c1-30-24-20(8-5-9-23(24)26)21-15-27-16-22(21)25(29)28-14-17-10-12-19(13-11-17)18-6-3-2-4-7-18/h2-9,15-17,19,27H,10-14H2,1H3,(H,28,29) |
| InChIKey | GFUCGOFTYPGLBC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |