C27H25F2N5O2 — CID 142287771
2-(5,7-difluoro-1H-indol-3-yl)-N-[(2R,3R)-3-methyl-2-bicyclo[2.2.2]octanyl]-6-(4-nitrophenyl)pyrimidin-4-amine (PubChem CID 142287771) has the molecular formula C27H25F2N5O2 and a molecular weight of 489.53 g/mol. Its IUPAC name is 2-(5,7-difluoro-1H-indol-3-yl)-N-[(2R,3R)-3-methyl-2-bicyclo[2.2.2]octanyl]-6-(4-nitrophenyl)pyrimidin-4-amine.
| Compound Name | 2-(5,7-difluoro-1H-indol-3-yl)-N-[(2R,3R)-3-methyl-2-bicyclo[2.2.2]octanyl]-6-(4-nitrophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 142287771 |
| Molecular Formula | C27H25F2N5O2 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 2-(5,7-difluoro-1H-indol-3-yl)-N-[(2R,3R)-3-methyl-2-bicyclo[2.2.2]octanyl]-6-(4-nitrophenyl)pyrimidin-4-amine |
| SMILES | C[C@@H]1C2CCC(CC2)[C@H]1Nc1cc(-c2ccc([N+](=O)[O-])cc2)nc(-c2c[nH]c3c(F)cc(F)cc23)n1 |
| InChI | InChI=1S/C27H25F2N5O2/c1-14-15-2-4-17(5-3-15)25(14)32-24-12-23(16-6-8-19(9-7-16)34(35)36)31-27(33-24)21-13-30-26-20(21)10-18(28)11-22(26)29/h6-15,17,25,30H,2-5H2,1H3,(H,31,32,33)/t14-,15?,17?,25+/m1/s1 |
| InChIKey | JKJAUJLQAVZTJN-LNDKSXQMSA-N |
| XLogP | 6.71 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|