C24H14F2N4OS — CID 142287907
2-(5,7-difluoro-1H-indol-3-yl)-6-phenoxathiin-3-ylpyrimidin-4-amine (PubChem CID 142287907) has the molecular formula C24H14F2N4OS and a molecular weight of 444.47 g/mol. Its IUPAC name is 2-(5,7-difluoro-1H-indol-3-yl)-6-phenoxathiin-3-ylpyrimidin-4-amine.
| Compound Name | 2-(5,7-difluoro-1H-indol-3-yl)-6-phenoxathiin-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 142287907 |
| Molecular Formula | C24H14F2N4OS |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 2-(5,7-difluoro-1H-indol-3-yl)-6-phenoxathiin-3-ylpyrimidin-4-amine |
| SMILES | Nc1cc(-c2ccc3c(c2)Oc2ccccc2S3)nc(-c2c[nH]c3c(F)cc(F)cc23)n1 |
| InChI | InChI=1S/C24H14F2N4OS/c25-13-8-14-15(11-28-23(14)16(26)9-13)24-29-17(10-22(27)30-24)12-5-6-21-19(7-12)31-18-3-1-2-4-20(18)32-21/h1-11,28H,(H2,27,29,30) |
| InChIKey | MDIFFAOBXQDAHB-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |