C29H26N2 — CID 142288324
(5E,6E)-2,3-bis(ethenyl)-6-ethylidene-1-naphthalen-2-yl-4-phenyl-5-prop-2-enylidenepyrazine (PubChem CID 142288324) has the molecular formula C29H26N2 and a molecular weight of 402.54 g/mol. Its IUPAC name is (5E,6E)-2,3-bis(ethenyl)-6-ethylidene-1-naphthalen-2-yl-4-phenyl-5-prop-2-enylidenepyrazine.
| Compound Name | (5E,6E)-2,3-bis(ethenyl)-6-ethylidene-1-naphthalen-2-yl-4-phenyl-5-prop-2-enylidenepyrazine |
|---|---|
| PubChem CID | 142288324 |
| Molecular Formula | C29H26N2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (5E,6E)-2,3-bis(ethenyl)-6-ethylidene-1-naphthalen-2-yl-4-phenyl-5-prop-2-enylidenepyrazine |
| SMILES | C=C/C=C1C(=C/C)\N(c2ccc3ccccc3c2)C(C=C)=C(C=C)N\1c1ccccc1 |
| InChI | InChI=1S/C29H26N2/c1-5-14-29-28(8-4)31(25-20-19-22-15-12-13-16-23(22)21-25)27(7-3)26(6-2)30(29)24-17-10-9-11-18-24/h5-21H,1-3H2,4H3/b28-8+,29-14+ |
| InChIKey | NQPABRZMTBOXSH-STANJUFISA-N |
| XLogP | 7.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |