C35H42N6O6 — CID 142289380
6-[[bis(pyridin-2-ylmethyl)amino]methyl]-N-[4-[2-[methyl-[(2S,3S,4R,5S)-2,3,5,6-tetrahydroxy-4-methylhexyl]amino]-2-oxoethyl]phenyl]pyridine-3-carboxamide (PubChem CID 142289380) has the molecular formula C35H42N6O6 and a molecular weight of 642.76 g/mol. Its IUPAC name is 6-[[bis(pyridin-2-ylmethyl)amino]methyl]-N-[4-[2-[methyl-[(2S,3S,4R,5S)-2,3,5,6-tetrahydroxy-4-methylhexyl]amino]-2-oxoethyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 6-[[bis(pyridin-2-ylmethyl)amino]methyl]-N-[4-[2-[methyl-[(2S,3S,4R,5S)-2,3,5,6-tetrahydroxy-4-methylhexyl]amino]-2-oxoethyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142289380 |
| Molecular Formula | C35H42N6O6 |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.32 |
| IUPAC Name | 6-[[bis(pyridin-2-ylmethyl)amino]methyl]-N-[4-[2-[methyl-[(2S,3S,4R,5S)-2,3,5,6-tetrahydroxy-4-methylhexyl]amino]-2-oxoethyl]phenyl]pyridine-3-carboxamide |
| SMILES | C[C@@H]([C@H](O)[C@@H](O)CN(C)C(=O)Cc1ccc(NC(=O)c2ccc(CN(Cc3ccccn3)Cc3ccccn3)nc2)cc1)[C@H](O)CO |
| InChI | InChI=1S/C35H42N6O6/c1-24(32(44)23-42)34(46)31(43)22-40(2)33(45)17-25-9-12-27(13-10-25)39-35(47)26-11-14-30(38-18-26)21-41(19-28-7-3-5-15-36-28)20-29-8-4-6-16-37-29/h3-16,18,24,31-32,34,42-44,46H,17,19-23H2,1-2H3,(H,39,47)/t24-,31+,32-,34+/m1/s1 |
| InChIKey | AKBFMEPTNQWPBR-RGOPZYLUSA-N |
| XLogP | 2.04 |
| TPSA | 172.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |