C26H22N6O4 — CID 1422913
(7S)-3,7-dimethyl-5,7-bis(4-nitrophenyl)-1-phenyl-6,8-dihydropyrazolo[4,5-b][1,4]diazepine (PubChem CID 1422913) has the molecular formula C26H22N6O4 and a molecular weight of 482.50 g/mol. Its IUPAC name is (7S)-3,7-dimethyl-5,7-bis(4-nitrophenyl)-1-phenyl-6,8-dihydropyrazolo[4,5-b][1,4]diazepine.
| Compound Name | (7S)-3,7-dimethyl-5,7-bis(4-nitrophenyl)-1-phenyl-6,8-dihydropyrazolo[4,5-b][1,4]diazepine |
|---|---|
| PubChem CID | 1422913 |
| Molecular Formula | C26H22N6O4 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | (7S)-3,7-dimethyl-5,7-bis(4-nitrophenyl)-1-phenyl-6,8-dihydropyrazolo[4,5-b][1,4]diazepine |
| SMILES | Cc1nn(-c2ccccc2)c2c1N=C(c1ccc([N+](=O)[O-])cc1)C[C@@](C)(c1ccc([N+](=O)[O-])cc1)N2 |
| InChI | InChI=1S/C26H22N6O4/c1-17-24-25(30(29-17)20-6-4-3-5-7-20)28-26(2,19-10-14-22(15-11-19)32(35)36)16-23(27-24)18-8-12-21(13-9-18)31(33)34/h3-15,28H,16H2,1-2H3/t26-/m0/s1 |
| InChIKey | ABPVUVKCKCGNSY-SANMLTNESA-N |
| XLogP | 5.85 |
| TPSA | 128.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|