C31H32BN9O9S — CID 142292412
2-[[4-[[2-amino-4-[(4-boronophenyl)methoxycarbonylamino]pteridin-6-yl]methyl-methylamino]benzoyl]amino]-5-oxo-5-(2-oxo-1,3-thiazolidin-3-yl)pentanoic acid (PubChem CID 142292412) has the molecular formula C31H32BN9O9S and a molecular weight of 717.53 g/mol. Its IUPAC name is 2-[[4-[[2-amino-4-[(4-boronophenyl)methoxycarbonylamino]pteridin-6-yl]methyl-methylamino]benzoyl]amino]-5-oxo-5-(2-oxo-1,3-thiazolidin-3-yl)pentanoic acid.
| Compound Name | 2-[[4-[[2-amino-4-[(4-boronophenyl)methoxycarbonylamino]pteridin-6-yl]methyl-methylamino]benzoyl]amino]-5-oxo-5-(2-oxo-1,3-thiazolidin-3-yl)pentanoic acid |
|---|---|
| PubChem CID | 142292412 |
| Molecular Formula | C31H32BN9O9S |
| Molecular Weight | 717.53 g/mol |
| Exact Mass | 717.21 |
| IUPAC Name | 2-[[4-[[2-amino-4-[(4-boronophenyl)methoxycarbonylamino]pteridin-6-yl]methyl-methylamino]benzoyl]amino]-5-oxo-5-(2-oxo-1,3-thiazolidin-3-yl)pentanoic acid |
| SMILES | CN(Cc1cnc2nc(N)nc(NC(=O)OCc3ccc(B(O)O)cc3)c2n1)c1ccc(C(=O)NC(CCC(=O)N2CCSC2=O)C(=O)O)cc1 |
| InChI | InChI=1S/C31H32BN9O9S/c1-40(21-8-4-18(5-9-21)27(43)36-22(28(44)45)10-11-23(42)41-12-13-51-31(41)47)15-20-14-34-25-24(35-20)26(38-29(33)37-25)39-30(46)50-16-17-2-6-19(7-3-17)32(48)49/h2-9,14,22,48-49H,10-13,15-16H2,1H3,(H,36,43)(H,44,45)(H3,33,34,37,38,39,46) |
| InChIKey | UQKKZNUKMABTFA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 263.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.53 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|