C25H29FN6O3 — CID 142295175
7-[2-[[1-[(Z)-2-amino-1-hydrazinylethenyl]cyclopropyl]amino]-2-oxoacetyl]-N-(4-fluorophenyl)-8-methyl-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide;ethene (PubChem CID 142295175) has the molecular formula C25H29FN6O3 and a molecular weight of 480.54 g/mol. Its IUPAC name is 7-[2-[[1-[(Z)-2-amino-1-hydrazinylethenyl]cyclopropyl]amino]-2-oxoacetyl]-N-(4-fluorophenyl)-8-methyl-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide;ethene.
| Compound Name | 7-[2-[[1-[(Z)-2-amino-1-hydrazinylethenyl]cyclopropyl]amino]-2-oxoacetyl]-N-(4-fluorophenyl)-8-methyl-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide;ethene |
|---|---|
| PubChem CID | 142295175 |
| Molecular Formula | C25H29FN6O3 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 7-[2-[[1-[(Z)-2-amino-1-hydrazinylethenyl]cyclopropyl]amino]-2-oxoacetyl]-N-(4-fluorophenyl)-8-methyl-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide;ethene |
| SMILES | C=C.Cc1c(C(=O)C(=O)NC2(/C(=C/N)NN)CC2)c2n(c1C(=O)Nc1ccc(F)cc1)C1CC1C2 |
| InChI | InChI=1S/C23H25FN6O3.C2H4/c1-11-18(20(31)22(33)28-23(6-7-23)17(10-25)29-26)16-9-12-8-15(12)30(16)19(11)21(32)27-14-4-2-13(24)3-5-14;1-2/h2-5,10,12,15,29H,6-9,25-26H2,1H3,(H,27,32)(H,28,33);1-2H2/b17-10-; |
| InChIKey | ICCCOMOIGMMZBF-HVHKRRFMSA-N |
| XLogP | 2.20 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|