C23H22F3N3O4S — CID 163689320
(2R,4R)-8-methyl-7-[2-[(3-methyl-1-methylidene-1-oxothietan-3-yl)amino]-2-oxoacetyl]-N-(3,4,5-trifluorophenyl)-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide (PubChem CID 163689320) has the molecular formula C23H22F3N3O4S and a molecular weight of 493.51 g/mol. Its IUPAC name is (2R,4R)-8-methyl-7-[2-[(3-methyl-1-methylidene-1-oxothietan-3-yl)amino]-2-oxoacetyl]-N-(3,4,5-trifluorophenyl)-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide.
| Compound Name | (2R,4R)-8-methyl-7-[2-[(3-methyl-1-methylidene-1-oxothietan-3-yl)amino]-2-oxoacetyl]-N-(3,4,5-trifluorophenyl)-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide |
|---|---|
| PubChem CID | 163689320 |
| Molecular Formula | C23H22F3N3O4S |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | (2R,4R)-8-methyl-7-[2-[(3-methyl-1-methylidene-1-oxothietan-3-yl)amino]-2-oxoacetyl]-N-(3,4,5-trifluorophenyl)-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide |
| SMILES | C=S1(=O)CC(C)(NC(=O)C(=O)c2c(C)c(C(=O)Nc3cc(F)c(F)c(F)c3)n3c2C[C@H]2C[C@H]23)C1 |
| InChI | InChI=1S/C23H22F3N3O4S/c1-10-17(20(30)22(32)28-23(2)8-34(3,33)9-23)16-5-11-4-15(11)29(16)19(10)21(31)27-12-6-13(24)18(26)14(25)7-12/h6-7,11,15H,3-5,8-9H2,1-2H3,(H,27,31)(H,28,32)/t11-,15-,23?,34?/m1/s1 |
| InChIKey | JROOLLNYEBNQSB-LTQKZEJPSA-N |
| XLogP | 2.37 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|