C19H18F2N2O4 — CID 142295211
2-[(5R)-3-[(3,4-difluorophenyl)carbamoyl]-2,5,6-trimethyl-6,7-dihydro-5H-pyrrolizin-1-yl]-2-oxoacetic acid (PubChem CID 142295211) has the molecular formula C19H18F2N2O4 and a molecular weight of 376.36 g/mol. Its IUPAC name is 2-[(5R)-3-[(3,4-difluorophenyl)carbamoyl]-2,5,6-trimethyl-6,7-dihydro-5H-pyrrolizin-1-yl]-2-oxoacetic acid.
| Compound Name | 2-[(5R)-3-[(3,4-difluorophenyl)carbamoyl]-2,5,6-trimethyl-6,7-dihydro-5H-pyrrolizin-1-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 142295211 |
| Molecular Formula | C19H18F2N2O4 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-[(5R)-3-[(3,4-difluorophenyl)carbamoyl]-2,5,6-trimethyl-6,7-dihydro-5H-pyrrolizin-1-yl]-2-oxoacetic acid |
| SMILES | Cc1c(C(=O)C(=O)O)c2n(c1C(=O)Nc1ccc(F)c(F)c1)[C@H](C)C(C)C2 |
| InChI | InChI=1S/C19H18F2N2O4/c1-8-6-14-15(17(24)19(26)27)9(2)16(23(14)10(8)3)18(25)22-11-4-5-12(20)13(21)7-11/h4-5,7-8,10H,6H2,1-3H3,(H,22,25)(H,26,27)/t8?,10-/m1/s1 |
| InChIKey | VRRGATUGVBUJSA-LHIURRSHSA-N |
| XLogP | 3.35 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|