C18H16F2N2O2 — CID 146512539
4-acetyl-N-(3,4-difluorophenyl)-3,5-dimethyl-1-prop-2-ynylpyrrole-2-carboxamide (PubChem CID 146512539) has the molecular formula C18H16F2N2O2 and a molecular weight of 330.33 g/mol. Its IUPAC name is 4-acetyl-N-(3,4-difluorophenyl)-3,5-dimethyl-1-prop-2-ynylpyrrole-2-carboxamide.
| Compound Name | 4-acetyl-N-(3,4-difluorophenyl)-3,5-dimethyl-1-prop-2-ynylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 146512539 |
| Molecular Formula | C18H16F2N2O2 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 4-acetyl-N-(3,4-difluorophenyl)-3,5-dimethyl-1-prop-2-ynylpyrrole-2-carboxamide |
| SMILES | C#CCn1c(C)c(C(C)=O)c(C)c1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H16F2N2O2/c1-5-8-22-11(3)16(12(4)23)10(2)17(22)18(24)21-13-6-7-14(19)15(20)9-13/h1,6-7,9H,8H2,2-4H3,(H,21,24) |
| InChIKey | HUQDZOHFTQZSQY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|