C25H31N3O6 — CID 1422957
methyl 2-[4-[(2R)-3-[tert-butyl-[(4-nitrophenyl)methyl]amino]-2-hydroxypropoxy]-1H-indol-3-yl]acetate (PubChem CID 1422957) has the molecular formula C25H31N3O6 and a molecular weight of 469.54 g/mol. Its IUPAC name is methyl 2-[4-[(2R)-3-[tert-butyl-[(4-nitrophenyl)methyl]amino]-2-hydroxypropoxy]-1H-indol-3-yl]acetate.
| Compound Name | methyl 2-[4-[(2R)-3-[tert-butyl-[(4-nitrophenyl)methyl]amino]-2-hydroxypropoxy]-1H-indol-3-yl]acetate |
|---|---|
| PubChem CID | 1422957 |
| Molecular Formula | C25H31N3O6 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | methyl 2-[4-[(2R)-3-[tert-butyl-[(4-nitrophenyl)methyl]amino]-2-hydroxypropoxy]-1H-indol-3-yl]acetate |
| SMILES | COC(=O)Cc1c[nH]c2cccc(OC[C@H](O)CN(Cc3ccc([N+](=O)[O-])cc3)C(C)(C)C)c12 |
| InChI | InChI=1S/C25H31N3O6/c1-25(2,3)27(14-17-8-10-19(11-9-17)28(31)32)15-20(29)16-34-22-7-5-6-21-24(22)18(13-26-21)12-23(30)33-4/h5-11,13,20,26,29H,12,14-16H2,1-4H3/t20-/m1/s1 |
| InChIKey | HEMKEGRAIBMAKZ-HXUWFJFHSA-N |
| XLogP | 3.83 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|