C44H44N4 — CID 142296230
(Z)-5-imino-2-methylidenepent-3-enimidamide;(2E)-2-methylpenta-2,4-dien-1-amine;9-[4-(3-methylphenyl)phenyl]-9-phenylfluorene (PubChem CID 142296230) has the molecular formula C44H44N4 and a molecular weight of 628.86 g/mol. Its IUPAC name is (Z)-5-imino-2-methylidenepent-3-enimidamide;(2E)-2-methylpenta-2,4-dien-1-amine;9-[4-(3-methylphenyl)phenyl]-9-phenylfluorene.
| Compound Name | (Z)-5-imino-2-methylidenepent-3-enimidamide;(2E)-2-methylpenta-2,4-dien-1-amine;9-[4-(3-methylphenyl)phenyl]-9-phenylfluorene |
|---|---|
| PubChem CID | 142296230 |
| Molecular Formula | C44H44N4 |
| Molecular Weight | 628.86 g/mol |
| Exact Mass | 628.36 |
| IUPAC Name | (Z)-5-imino-2-methylidenepent-3-enimidamide;(2E)-2-methylpenta-2,4-dien-1-amine;9-[4-(3-methylphenyl)phenyl]-9-phenylfluorene |
| SMILES | C=C/C=C(\C)CN.Cc1cccc(-c2ccc(C3(c4ccccc4)c4ccccc4-c4ccccc43)cc2)c1.[H]/N=C(\N)C(=C)/C=C\C=N\[H] |
| InChI | InChI=1S/C32H24.C6H9N3.C6H11N/c1-23-10-9-11-25(22-23)24-18-20-27(21-19-24)32(26-12-3-2-4-13-26)30-16-7-5-14-28(30)29-15-6-8-17-31(29)32;1-5(6(8)9)3-2-4-7;1-3-4-6(2)5-7/h2-22H,1H3;2-4,7H,1H2,(H3,8,9);3-4H,1,5,7H2,2H3/b;3-2-,7-4+;6-4+ |
| InChIKey | SRCBIMFIFZQLMN-YTWTZKAYSA-N |
| XLogP | 9.79 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.86 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|