C45H40N4 — CID 142296219
(2E,4Z)-5-amino-N'-[(1Z,5Z)-7-imino-4-methylidene-1-[3-[4-(9-phenylfluoren-9-yl)phenyl]phenyl]hepta-1,5-dienyl]-2-methylpenta-2,4-dienimidamide (PubChem CID 142296219) has the molecular formula C45H40N4 and a molecular weight of 636.84 g/mol. Its IUPAC name is (2E,4Z)-5-amino-N'-[(1Z,5Z)-7-imino-4-methylidene-1-[3-[4-(9-phenylfluoren-9-yl)phenyl]phenyl]hepta-1,5-dienyl]-2-methylpenta-2,4-dienimidamide.
| Compound Name | (2E,4Z)-5-amino-N'-[(1Z,5Z)-7-imino-4-methylidene-1-[3-[4-(9-phenylfluoren-9-yl)phenyl]phenyl]hepta-1,5-dienyl]-2-methylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 142296219 |
| Molecular Formula | C45H40N4 |
| Molecular Weight | 636.84 g/mol |
| Exact Mass | 636.33 |
| IUPAC Name | (2E,4Z)-5-amino-N'-[(1Z,5Z)-7-imino-4-methylidene-1-[3-[4-(9-phenylfluoren-9-yl)phenyl]phenyl]hepta-1,5-dienyl]-2-methylpenta-2,4-dienimidamide |
| SMILES | [H]/N=C/C=C\C(=C)C/C=C(\N=C(N)\C(C)=C\C=C/N)c1cccc(-c2ccc(C3(c4ccccc4)c4ccccc4-c4ccccc43)cc2)c1 |
| InChI | InChI=1S/C45H40N4/c1-32(13-11-29-46)23-28-43(49-44(48)33(2)14-12-30-47)36-16-10-15-35(31-36)34-24-26-38(27-25-34)45(37-17-4-3-5-18-37)41-21-8-6-19-39(41)40-20-7-9-22-42(40)45/h3-22,24-31,46H,1,23,47H2,2H3,(H2,48,49)/b13-11-,30-12-,33-14+,43-28-,46-29+ |
| InChIKey | SWBFKZHHZLKPEA-MQRFGQOFSA-N |
| XLogP | 9.99 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.84 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|