C18H26F3N3OS — CID 142296710
2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-[4-[(2E,4E)-2-fluorohepta-2,4-dien-4-yl]oxypiperidin-1-yl]ethanamine (PubChem CID 142296710) has the molecular formula C18H26F3N3OS and a molecular weight of 389.49 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-[4-[(2E,4E)-2-fluorohepta-2,4-dien-4-yl]oxypiperidin-1-yl]ethanamine.
| Compound Name | 2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-[4-[(2E,4E)-2-fluorohepta-2,4-dien-4-yl]oxypiperidin-1-yl]ethanamine |
|---|---|
| PubChem CID | 142296710 |
| Molecular Formula | C18H26F3N3OS |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-[4-[(2E,4E)-2-fluorohepta-2,4-dien-4-yl]oxypiperidin-1-yl]ethanamine |
| SMILES | CC/C=C(\C=C(/C)F)OC1CCN(C(CN)c2scnc2C(F)F)CC1 |
| InChI | InChI=1S/C18H26F3N3OS/c1-3-4-14(9-12(2)19)25-13-5-7-24(8-6-13)15(10-22)17-16(18(20)21)23-11-26-17/h4,9,11,13,15,18H,3,5-8,10,22H2,1-2H3/b12-9+,14-4+ |
| InChIKey | OUWSVYIIONYLEQ-ISLLAGQOSA-N |
| XLogP | 4.73 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|