C19H25F2N5OS — CID 167120422
(2E,4E)-4-[[1-[2-amino-1-[4-(difluoromethyl)-1,3-thiazol-5-yl]ethyl]piperidin-4-yl]methoxy]-2-methyl-5-(methylideneamino)penta-2,4-dienenitrile (PubChem CID 167120422) has the molecular formula C19H25F2N5OS and a molecular weight of 409.51 g/mol. Its IUPAC name is (2E,4E)-4-[[1-[2-amino-1-[4-(difluoromethyl)-1,3-thiazol-5-yl]ethyl]piperidin-4-yl]methoxy]-2-methyl-5-(methylideneamino)penta-2,4-dienenitrile.
| Compound Name | (2E,4E)-4-[[1-[2-amino-1-[4-(difluoromethyl)-1,3-thiazol-5-yl]ethyl]piperidin-4-yl]methoxy]-2-methyl-5-(methylideneamino)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 167120422 |
| Molecular Formula | C19H25F2N5OS |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (2E,4E)-4-[[1-[2-amino-1-[4-(difluoromethyl)-1,3-thiazol-5-yl]ethyl]piperidin-4-yl]methoxy]-2-methyl-5-(methylideneamino)penta-2,4-dienenitrile |
| SMILES | C=N/C=C(\C=C(/C)C#N)OCC1CCN(C(CN)c2scnc2C(F)F)CC1 |
| InChI | InChI=1S/C19H25F2N5OS/c1-13(8-22)7-15(10-24-2)27-11-14-3-5-26(6-4-14)16(9-23)18-17(19(20)21)25-12-28-18/h7,10,12,14,16,19H,2-6,9,11,23H2,1H3/b13-7+,15-10+ |
| InChIKey | ZJHWIRHNZVHWJV-OOVVNSOSSA-N |
| XLogP | 3.82 |
| TPSA | 87.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|