C17H22F3N5O2S — CID 174013628
N-[(Z)-1-[[1-[1-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-nitrosoethyl]piperidin-4-yl]methoxy]-2-fluoro-2-(methylideneamino)ethenyl]ethanimine (PubChem CID 174013628) has the molecular formula C17H22F3N5O2S and a molecular weight of 417.46 g/mol. Its IUPAC name is N-[(Z)-1-[[1-[1-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-nitrosoethyl]piperidin-4-yl]methoxy]-2-fluoro-2-(methylideneamino)ethenyl]ethanimine.
| Compound Name | N-[(Z)-1-[[1-[1-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-nitrosoethyl]piperidin-4-yl]methoxy]-2-fluoro-2-(methylideneamino)ethenyl]ethanimine |
|---|---|
| PubChem CID | 174013628 |
| Molecular Formula | C17H22F3N5O2S |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N-[(Z)-1-[[1-[1-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-nitrosoethyl]piperidin-4-yl]methoxy]-2-fluoro-2-(methylideneamino)ethenyl]ethanimine |
| SMILES | C=N/C(F)=C(\N=CC)OCC1CCN(C(CN=O)c2scnc2C(F)F)CC1 |
| InChI | InChI=1S/C17H22F3N5O2S/c1-3-22-17(16(20)21-2)27-9-11-4-6-25(7-5-11)12(8-24-26)14-13(15(18)19)23-10-28-14/h3,10-12,15H,2,4-9H2,1H3/b17-16+,22-3? |
| InChIKey | KVIRQDMPEGTNQR-DJYFPSOPSA-N |
| XLogP | 4.50 |
| TPSA | 79.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|