C13H14F2N4O — CID 142298661
5-(2-cyclobutyl-1H-imidazol-5-yl)-3-(difluoromethoxy)pyridin-2-amine (PubChem CID 142298661) has the molecular formula C13H14F2N4O and a molecular weight of 280.28 g/mol. Its IUPAC name is 5-(2-cyclobutyl-1H-imidazol-5-yl)-3-(difluoromethoxy)pyridin-2-amine.
| Compound Name | 5-(2-cyclobutyl-1H-imidazol-5-yl)-3-(difluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 142298661 |
| Molecular Formula | C13H14F2N4O |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 5-(2-cyclobutyl-1H-imidazol-5-yl)-3-(difluoromethoxy)pyridin-2-amine |
| SMILES | Nc1ncc(-c2cnc(C3CCC3)[nH]2)cc1OC(F)F |
| InChI | InChI=1S/C13H14F2N4O/c14-13(15)20-10-4-8(5-17-11(10)16)9-6-18-12(19-9)7-2-1-3-7/h4-7,13H,1-3H2,(H2,16,17)(H,18,19) |
| InChIKey | DCKXULZBNCZYLC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |