C24H32N2O4S — CID 142298887
3-[[2-methyl-3-[2-methyl-3-(3-pyrrolidin-1-ylpropoxy)phenyl]phenyl]sulfinylamino]propanoic acid (PubChem CID 142298887) has the molecular formula C24H32N2O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is 3-[[2-methyl-3-[2-methyl-3-(3-pyrrolidin-1-ylpropoxy)phenyl]phenyl]sulfinylamino]propanoic acid.
| Compound Name | 3-[[2-methyl-3-[2-methyl-3-(3-pyrrolidin-1-ylpropoxy)phenyl]phenyl]sulfinylamino]propanoic acid |
|---|---|
| PubChem CID | 142298887 |
| Molecular Formula | C24H32N2O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 3-[[2-methyl-3-[2-methyl-3-(3-pyrrolidin-1-ylpropoxy)phenyl]phenyl]sulfinylamino]propanoic acid |
| SMILES | Cc1c(OCCCN2CCCC2)cccc1-c1cccc(S(=O)NCCC(=O)O)c1C |
| InChI | InChI=1S/C24H32N2O4S/c1-18-20(8-5-10-22(18)30-17-7-16-26-14-3-4-15-26)21-9-6-11-23(19(21)2)31(29)25-13-12-24(27)28/h5-6,8-11,25H,3-4,7,12-17H2,1-2H3,(H,27,28) |
| InChIKey | SYJKFSLOOFRHTO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|