C15H19N — CID 142301622
N-[(4Z,6Z)-octa-1,4,6-trien-3-yl]cyclohepta-2,4,6-trien-1-amine (PubChem CID 142301622) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is N-[(4Z,6Z)-octa-1,4,6-trien-3-yl]cyclohepta-2,4,6-trien-1-amine.
| Compound Name | N-[(4Z,6Z)-octa-1,4,6-trien-3-yl]cyclohepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 142301622 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | N-[(4Z,6Z)-octa-1,4,6-trien-3-yl]cyclohepta-2,4,6-trien-1-amine |
| SMILES | C=CC(/C=C\C=C/C)NC1C=CC=CC=C1 |
| InChI | InChI=1S/C15H19N/c1-3-5-8-11-14(4-2)16-15-12-9-6-7-10-13-15/h3-16H,2H2,1H3/b5-3-,11-8- |
| InChIKey | HEUYEVNAEDDVFT-KIQZHRSFSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|