C13H20F3N — CID 163652398
(2E,4E,6E)-N-propan-2-yl-7-(trifluoromethyl)nona-2,4,6-trien-1-amine (PubChem CID 163652398) has the molecular formula C13H20F3N and a molecular weight of 247.30 g/mol. Its IUPAC name is (2E,4E,6E)-N-propan-2-yl-7-(trifluoromethyl)nona-2,4,6-trien-1-amine.
| Compound Name | (2E,4E,6E)-N-propan-2-yl-7-(trifluoromethyl)nona-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 163652398 |
| Molecular Formula | C13H20F3N |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | (2E,4E,6E)-N-propan-2-yl-7-(trifluoromethyl)nona-2,4,6-trien-1-amine |
| SMILES | CC/C(=C\C=C\C=C\CNC(C)C)C(F)(F)F |
| InChI | InChI=1S/C13H20F3N/c1-4-12(13(14,15)16)9-7-5-6-8-10-17-11(2)3/h5-9,11,17H,4,10H2,1-3H3/b7-5+,8-6+,12-9+ |
| InChIKey | INHWDHVGLCHTIT-DCMLSGFISA-N |
| XLogP | 4.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|