About 5,7-difluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid
5,7-difluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid (PubChem CID 142301727) has the molecular formula C10H7F2NO3
and a molecular weight of 227.17 g/mol. Its IUPAC name is 5,7-difluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid.
Analyze 5,7-difluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-difluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid?
The IUPAC name of 5,7-difluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid (CID 142301727) is 5,7-difluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid.
What is the SMILES notation for 5,7-difluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid?
The canonical SMILES for 5,7-difluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid is O=C1CC(C(=O)O)c2c(F)cc(F)cc2N1.
What is the InChIKey of 5,7-difluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid?
The InChIKey is XCPUQDUNVVEHDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F2NO3/c11-4-1-6(12)9-5(10(15)16)3-8(14)13-7(9)2-4/h1-2,5H,3H2,(H,13,14)(H,15,16).
What are the key properties of 5,7-difluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid?
5,7-difluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid has a molecular weight of 227.17 g/mol, XLogP of 1.48, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-difluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxylic acid is sourced from PubChem (CID 142301727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).