About ethane;(4E,5E)-5-ethylidene-2-methyl-4-prop-2-enylidene-1,3-thiazole
ethane;(4E,5E)-5-ethylidene-2-methyl-4-prop-2-enylidene-1,3-thiazole (PubChem CID 142302136) has the molecular formula C13H23NS
and a molecular weight of 225.40 g/mol. Its IUPAC name is ethane;(4E,5E)-5-ethylidene-2-methyl-4-prop-2-enylidene-1,3-thiazole.
Molecular Properties
| Compound Name | ethane;(4E,5E)-5-ethylidene-2-methyl-4-prop-2-enylidene-1,3-thiazole |
| PubChem CID | 142302136 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | ethane;(4E,5E)-5-ethylidene-2-methyl-4-prop-2-enylidene-1,3-thiazole |
| SMILES | C=C/C=c1/nc(C)s/c1=C/C.CC.CC |
| InChI | InChI=1S/C9H11NS.2C2H6/c1-4-6-8-9(5-2)11-7(3)10-8;2*1-2/h4-6H,1H2,2-3H3;2*1-2H3/b8-6+,9-5+;; |
| InChIKey | CHLFQYHOALMDKQ-VLGINLMBSA-N |
| XLogP | 3.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(4E,5E)-5-ethylidene-2-methyl-4-prop-2-enylidene-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4E,5E)-5-ethylidene-2-methyl-4-prop-2-enylidene-1,3-thiazole?
The IUPAC name of ethane;(4E,5E)-5-ethylidene-2-methyl-4-prop-2-enylidene-1,3-thiazole (CID 142302136) is ethane;(4E,5E)-5-ethylidene-2-methyl-4-prop-2-enylidene-1,3-thiazole.
What is the SMILES notation for ethane;(4E,5E)-5-ethylidene-2-methyl-4-prop-2-enylidene-1,3-thiazole?
The canonical SMILES for ethane;(4E,5E)-5-ethylidene-2-methyl-4-prop-2-enylidene-1,3-thiazole is C=C/C=c1/nc(C)s/c1=C/C.CC.CC.
What is the InChIKey of ethane;(4E,5E)-5-ethylidene-2-methyl-4-prop-2-enylidene-1,3-thiazole?
The InChIKey is CHLFQYHOALMDKQ-VLGINLMBSA-N. The full InChI is InChI=1S/C9H11NS.2C2H6/c1-4-6-8-9(5-2)11-7(3)10-8;2*1-2/h4-6H,1H2,2-3H3;2*1-2H3/b8-6+,9-5+;;.
What are the key properties of ethane;(4E,5E)-5-ethylidene-2-methyl-4-prop-2-enylidene-1,3-thiazole?
ethane;(4E,5E)-5-ethylidene-2-methyl-4-prop-2-enylidene-1,3-thiazole has a molecular weight of 225.40 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4E,5E)-5-ethylidene-2-methyl-4-prop-2-enylidene-1,3-thiazole is sourced from PubChem (CID 142302136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).