C38H38N2O5 — CID 142303114
9H-fluoren-9-ylmethyl (E,2R)-7-[[1-[4-(hydroxymethyl)anilino]-1-oxo-3-phenylpropan-2-yl]amino]-2-methyl-7-oxohept-3-enoate (PubChem CID 142303114) has the molecular formula C38H38N2O5 and a molecular weight of 602.73 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (E,2R)-7-[[1-[4-(hydroxymethyl)anilino]-1-oxo-3-phenylpropan-2-yl]amino]-2-methyl-7-oxohept-3-enoate.
| Compound Name | 9H-fluoren-9-ylmethyl (E,2R)-7-[[1-[4-(hydroxymethyl)anilino]-1-oxo-3-phenylpropan-2-yl]amino]-2-methyl-7-oxohept-3-enoate |
|---|---|
| PubChem CID | 142303114 |
| Molecular Formula | C38H38N2O5 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (E,2R)-7-[[1-[4-(hydroxymethyl)anilino]-1-oxo-3-phenylpropan-2-yl]amino]-2-methyl-7-oxohept-3-enoate |
| SMILES | C[C@H](/C=C/CCC(=O)NC(Cc1ccccc1)C(=O)Nc1ccc(CO)cc1)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C38H38N2O5/c1-26(38(44)45-25-34-32-16-8-6-14-30(32)31-15-7-9-17-33(31)34)11-5-10-18-36(42)40-35(23-27-12-3-2-4-13-27)37(43)39-29-21-19-28(24-41)20-22-29/h2-9,11-17,19-22,26,34-35,41H,10,18,23-25H2,1H3,(H,39,43)(H,40,42)/b11-5+/t26-,35?/m1/s1 |
| InChIKey | BYFYPWFLDCWODP-RWVKJZTOSA-N |
| XLogP | 6.17 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|