C39H45N3O5 — CID 159398898
azane;9H-fluoren-9-ylmethyl (2S,5R)-2-benzyl-5-[[4-(hydroxymethyl)phenyl]carbamoyl]-9-(methylamino)-3-oxononanoate (PubChem CID 159398898) has the molecular formula C39H45N3O5 and a molecular weight of 635.81 g/mol. Its IUPAC name is azane;9H-fluoren-9-ylmethyl (2S,5R)-2-benzyl-5-[[4-(hydroxymethyl)phenyl]carbamoyl]-9-(methylamino)-3-oxononanoate.
| Compound Name | azane;9H-fluoren-9-ylmethyl (2S,5R)-2-benzyl-5-[[4-(hydroxymethyl)phenyl]carbamoyl]-9-(methylamino)-3-oxononanoate |
|---|---|
| PubChem CID | 159398898 |
| Molecular Formula | C39H45N3O5 |
| Molecular Weight | 635.81 g/mol |
| Exact Mass | 635.34 |
| IUPAC Name | azane;9H-fluoren-9-ylmethyl (2S,5R)-2-benzyl-5-[[4-(hydroxymethyl)phenyl]carbamoyl]-9-(methylamino)-3-oxononanoate |
| SMILES | CNCCCC[C@H](CC(=O)[C@H](Cc1ccccc1)C(=O)OCC1c2ccccc2-c2ccccc21)C(=O)Nc1ccc(CO)cc1.N |
| InChI | InChI=1S/C39H42N2O5.H3N/c1-40-22-10-9-13-29(38(44)41-30-20-18-28(25-42)19-21-30)24-37(43)35(23-27-11-3-2-4-12-27)39(45)46-26-36-33-16-7-5-14-31(33)32-15-6-8-17-34(32)36;/h2-8,11-12,14-21,29,35-36,40,42H,9-10,13,22-26H2,1H3,(H,41,44);1H3/t29-,35+;/m1./s1 |
| InChIKey | BXVXWRHFMZVBOH-UDVHLTMJSA-N |
| XLogP | 6.46 |
| TPSA | 139.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.81 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|