C14H16F2N4O2S — CID 142305384
acetamide;N-cyclopropylsulfanyl-1-[3-(2,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine (PubChem CID 142305384) has the molecular formula C14H16F2N4O2S and a molecular weight of 342.37 g/mol. Its IUPAC name is acetamide;N-cyclopropylsulfanyl-1-[3-(2,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine.
| Compound Name | acetamide;N-cyclopropylsulfanyl-1-[3-(2,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 142305384 |
| Molecular Formula | C14H16F2N4O2S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | acetamide;N-cyclopropylsulfanyl-1-[3-(2,5-difluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine |
| SMILES | CC(N)=O.Fc1ccc(F)c(-c2noc(CNSC3CC3)n2)c1 |
| InChI | InChI=1S/C12H11F2N3OS.C2H5NO/c13-7-1-4-10(14)9(5-7)12-16-11(18-17-12)6-15-19-8-2-3-8;1-2(3)4/h1,4-5,8,15H,2-3,6H2;1H3,(H2,3,4) |
| InChIKey | ONNUHCNKHXPCLY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|