C14H15F3N4O4S — CID 142305716
[(Z)-[2-ethylsulfonyl-1-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]ethylidene]amino] acetate (PubChem CID 142305716) has the molecular formula C14H15F3N4O4S and a molecular weight of 392.36 g/mol. Its IUPAC name is [(Z)-[2-ethylsulfonyl-1-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]ethylidene]amino] acetate.
| Compound Name | [(Z)-[2-ethylsulfonyl-1-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]ethylidene]amino] acetate |
|---|---|
| PubChem CID | 142305716 |
| Molecular Formula | C14H15F3N4O4S |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | [(Z)-[2-ethylsulfonyl-1-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]ethylidene]amino] acetate |
| SMILES | CCS(=O)(=O)C/C(=N\OC(C)=O)c1nc2cc(C(F)(F)F)cnc2n1C |
| InChI | InChI=1S/C14H15F3N4O4S/c1-4-26(23,24)7-11(20-25-8(2)22)13-19-10-5-9(14(15,16)17)6-18-12(10)21(13)3/h5-6H,4,7H2,1-3H3/b20-11+ |
| InChIKey | CTDKVOSFYWFGMY-RGVLZGJSSA-N |
| XLogP | 1.69 |
| TPSA | 103.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|