C22H19N5O2S2 — CID 142306321
ethenyl N-methyl-4-[[(6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carbonyl)amino]methyl]pyrazole-1-carboximidothioate (PubChem CID 142306321) has the molecular formula C22H19N5O2S2 and a molecular weight of 449.56 g/mol. Its IUPAC name is ethenyl N-methyl-4-[[(6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carbonyl)amino]methyl]pyrazole-1-carboximidothioate.
| Compound Name | ethenyl N-methyl-4-[[(6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carbonyl)amino]methyl]pyrazole-1-carboximidothioate |
|---|---|
| PubChem CID | 142306321 |
| Molecular Formula | C22H19N5O2S2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | ethenyl N-methyl-4-[[(6-oxo-5H-benzo[b][1,4]benzothiazepine-3-carbonyl)amino]methyl]pyrazole-1-carboximidothioate |
| SMILES | C=CS/C(=N\C)n1cc(CNC(=O)c2ccc3c(c2)NC(=O)c2ccccc2S3)cn1 |
| InChI | InChI=1S/C22H19N5O2S2/c1-3-30-22(23-2)27-13-14(12-25-27)11-24-20(28)15-8-9-19-17(10-15)26-21(29)16-6-4-5-7-18(16)31-19/h3-10,12-13H,1,11H2,2H3,(H,24,28)(H,26,29)/b23-22- |
| InChIKey | BJDMDPZWLPANEJ-FCQUAONHSA-N |
| XLogP | 4.24 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|