C26H30FN3O2 — CID 142306774
3-(2-amino-4-hydroxy-6-methylphenyl)propanamide;6-[(2-fluorophenyl)methyl]-1,2,3,4-tetrahydroquinoline (PubChem CID 142306774) has the molecular formula C26H30FN3O2 and a molecular weight of 435.54 g/mol. Its IUPAC name is 3-(2-amino-4-hydroxy-6-methylphenyl)propanamide;6-[(2-fluorophenyl)methyl]-1,2,3,4-tetrahydroquinoline.
| Compound Name | 3-(2-amino-4-hydroxy-6-methylphenyl)propanamide;6-[(2-fluorophenyl)methyl]-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 142306774 |
| Molecular Formula | C26H30FN3O2 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 3-(2-amino-4-hydroxy-6-methylphenyl)propanamide;6-[(2-fluorophenyl)methyl]-1,2,3,4-tetrahydroquinoline |
| SMILES | Cc1cc(O)cc(N)c1CCC(N)=O.Fc1ccccc1Cc1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C16H16FN.C10H14N2O2/c17-15-6-2-1-4-13(15)10-12-7-8-16-14(11-12)5-3-9-18-16;1-6-4-7(13)5-9(11)8(6)2-3-10(12)14/h1-2,4,6-8,11,18H,3,5,9-10H2;4-5,13H,2-3,11H2,1H3,(H2,12,14) |
| InChIKey | FSMJVSNQPXOABX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|