C22H24FNO5 — CID 145042148
(2S,5S,6R)-2-[4-fluoro-3-(1,2,3,4-tetrahydroquinolin-6-ylmethyl)phenyl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-one (PubChem CID 145042148) has the molecular formula C22H24FNO5 and a molecular weight of 401.43 g/mol. Its IUPAC name is (2S,5S,6R)-2-[4-fluoro-3-(1,2,3,4-tetrahydroquinolin-6-ylmethyl)phenyl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-one.
| Compound Name | (2S,5S,6R)-2-[4-fluoro-3-(1,2,3,4-tetrahydroquinolin-6-ylmethyl)phenyl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-one |
|---|---|
| PubChem CID | 145042148 |
| Molecular Formula | C22H24FNO5 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (2S,5S,6R)-2-[4-fluoro-3-(1,2,3,4-tetrahydroquinolin-6-ylmethyl)phenyl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-one |
| SMILES | O=C1C(O)[C@H](c2ccc(F)c(Cc3ccc4c(c3)CCCN4)c2)O[C@H](CO)[C@@H]1O |
| InChI | InChI=1S/C22H24FNO5/c23-16-5-4-14(22-21(28)20(27)19(26)18(11-25)29-22)10-15(16)9-12-3-6-17-13(8-12)2-1-7-24-17/h3-6,8,10,18-19,21-22,24-26,28H,1-2,7,9,11H2/t18-,19+,21?,22+/m1/s1 |
| InChIKey | MEPMUYFHANGNFI-DMZAVKPHSA-N |
| XLogP | 1.50 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |