C16H16ClN — CID 67963438
5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole (PubChem CID 67963438) has the molecular formula C16H16ClN and a molecular weight of 257.76 g/mol. Its IUPAC name is 5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole.
| Compound Name | 5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 67963438 |
| Molecular Formula | C16H16ClN |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole |
| SMILES | ClCc1ccccc1Cc1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C16H16ClN/c17-11-15-4-2-1-3-13(15)9-12-5-6-16-14(10-12)7-8-18-16/h1-6,10,18H,7-9,11H2 |
| InChIKey | PMGIRMKNFFOUAH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|