About 5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole
5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole (PubChem CID 67963438) has the molecular formula C16H16ClN
and a molecular weight of 257.76 g/mol. Its IUPAC name is 5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole |
| PubChem CID | 67963438 |
| Molecular Formula | C16H16ClN |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole |
| SMILES | ClCc1ccccc1Cc1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C16H16ClN/c17-11-15-4-2-1-3-13(15)9-12-5-6-16-14(10-12)7-8-18-16/h1-6,10,18H,7-9,11H2 |
| InChIKey | PMGIRMKNFFOUAH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole?
The IUPAC name of 5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole (CID 67963438) is 5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole.
What is the SMILES notation for 5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole?
The canonical SMILES for 5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole is ClCc1ccccc1Cc1ccc2c(c1)CCN2.
What is the InChIKey of 5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole?
The InChIKey is PMGIRMKNFFOUAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN/c17-11-15-4-2-1-3-13(15)9-12-5-6-16-14(10-12)7-8-18-16/h1-6,10,18H,7-9,11H2.
What are the key properties of 5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole?
5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole has a molecular weight of 257.76 g/mol, XLogP of 3.98, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2-(chloromethyl)phenyl]methyl]-2,3-dihydro-1H-indole is sourced from PubChem (CID 67963438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).