C20H25NO — CID 142307127
6-benzyl-8-methoxy-4-propan-2-yl-1,2,3,4-tetrahydroquinoline (PubChem CID 142307127) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 6-benzyl-8-methoxy-4-propan-2-yl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-benzyl-8-methoxy-4-propan-2-yl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 142307127 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 6-benzyl-8-methoxy-4-propan-2-yl-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1cc(Cc2ccccc2)cc2c1NCCC2C(C)C |
| InChI | InChI=1S/C20H25NO/c1-14(2)17-9-10-21-20-18(17)12-16(13-19(20)22-3)11-15-7-5-4-6-8-15/h4-8,12-14,17,21H,9-11H2,1-3H3 |
| InChIKey | FJWJZXPDGZTVMF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |