C29H35N3O2 — CID 134338768
(2S)-2-amino-N-[(4R)-6-benzyl-8-methoxy-1,2,3,4-tetrahydroquinolin-4-yl]-3-(2,4,6-trimethylphenyl)propanamide (PubChem CID 134338768) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is (2S)-2-amino-N-[(4R)-6-benzyl-8-methoxy-1,2,3,4-tetrahydroquinolin-4-yl]-3-(2,4,6-trimethylphenyl)propanamide.
| Compound Name | (2S)-2-amino-N-[(4R)-6-benzyl-8-methoxy-1,2,3,4-tetrahydroquinolin-4-yl]-3-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 134338768 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | (2S)-2-amino-N-[(4R)-6-benzyl-8-methoxy-1,2,3,4-tetrahydroquinolin-4-yl]-3-(2,4,6-trimethylphenyl)propanamide |
| SMILES | COc1cc(Cc2ccccc2)cc2c1NCC[C@H]2NC(=O)[C@@H](N)Cc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C29H35N3O2/c1-18-12-19(2)23(20(3)13-18)17-25(30)29(33)32-26-10-11-31-28-24(26)15-22(16-27(28)34-4)14-21-8-6-5-7-9-21/h5-9,12-13,15-16,25-26,31H,10-11,14,17,30H2,1-4H3,(H,32,33)/t25-,26+/m0/s1 |
| InChIKey | HHENSMNAUXMCQB-IZZNHLLZSA-N |
| XLogP | 4.75 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |