C28H33N3O — CID 134338725
(2S)-2-amino-N-[(4R)-7-benzyl-1,2,3,4-tetrahydroquinolin-4-yl]-3-(2,4,6-trimethylphenyl)propanamide (PubChem CID 134338725) has the molecular formula C28H33N3O and a molecular weight of 427.59 g/mol. Its IUPAC name is (2S)-2-amino-N-[(4R)-7-benzyl-1,2,3,4-tetrahydroquinolin-4-yl]-3-(2,4,6-trimethylphenyl)propanamide.
| Compound Name | (2S)-2-amino-N-[(4R)-7-benzyl-1,2,3,4-tetrahydroquinolin-4-yl]-3-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 134338725 |
| Molecular Formula | C28H33N3O |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | (2S)-2-amino-N-[(4R)-7-benzyl-1,2,3,4-tetrahydroquinolin-4-yl]-3-(2,4,6-trimethylphenyl)propanamide |
| SMILES | Cc1cc(C)c(C[C@H](N)C(=O)N[C@@H]2CCNc3cc(Cc4ccccc4)ccc32)c(C)c1 |
| InChI | InChI=1S/C28H33N3O/c1-18-13-19(2)24(20(3)14-18)17-25(29)28(32)31-26-11-12-30-27-16-22(9-10-23(26)27)15-21-7-5-4-6-8-21/h4-10,13-14,16,25-26,30H,11-12,15,17,29H2,1-3H3,(H,31,32)/t25-,26+/m0/s1 |
| InChIKey | QHJITPWHKHNQLT-IZZNHLLZSA-N |
| XLogP | 4.75 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |