C31H39N3O — CID 134338621
2-amino-N-(6-benzyl-8-propyl-1,2,3,4-tetrahydroquinolin-4-yl)-3-(2,4,6-trimethylphenyl)propanamide (PubChem CID 134338621) has the molecular formula C31H39N3O and a molecular weight of 469.67 g/mol. Its IUPAC name is 2-amino-N-(6-benzyl-8-propyl-1,2,3,4-tetrahydroquinolin-4-yl)-3-(2,4,6-trimethylphenyl)propanamide.
| Compound Name | 2-amino-N-(6-benzyl-8-propyl-1,2,3,4-tetrahydroquinolin-4-yl)-3-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 134338621 |
| Molecular Formula | C31H39N3O |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.31 |
| IUPAC Name | 2-amino-N-(6-benzyl-8-propyl-1,2,3,4-tetrahydroquinolin-4-yl)-3-(2,4,6-trimethylphenyl)propanamide |
| SMILES | CCCc1cc(Cc2ccccc2)cc2c1NCCC2NC(=O)C(N)Cc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C31H39N3O/c1-5-9-25-17-24(16-23-10-7-6-8-11-23)18-27-29(12-13-33-30(25)27)34-31(35)28(32)19-26-21(3)14-20(2)15-22(26)4/h6-8,10-11,14-15,17-18,28-29,33H,5,9,12-13,16,19,32H2,1-4H3,(H,34,35) |
| InChIKey | DXQJTKYAZQNXSV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |