C31H37N3O — CID 134338774
(2S)-2-amino-N-[(4R)-7-benzyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-4-yl]-3-(2,4,6-trimethylphenyl)propanamide (PubChem CID 134338774) has the molecular formula C31H37N3O and a molecular weight of 467.66 g/mol. Its IUPAC name is (2S)-2-amino-N-[(4R)-7-benzyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-4-yl]-3-(2,4,6-trimethylphenyl)propanamide.
| Compound Name | (2S)-2-amino-N-[(4R)-7-benzyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-4-yl]-3-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 134338774 |
| Molecular Formula | C31H37N3O |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | (2S)-2-amino-N-[(4R)-7-benzyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-4-yl]-3-(2,4,6-trimethylphenyl)propanamide |
| SMILES | Cc1cc(C)c(C[C@H](N)C(=O)N[C@@H]2CCN3CCCc4cc(Cc5ccccc5)cc2c43)c(C)c1 |
| InChI | InChI=1S/C31H37N3O/c1-20-14-21(2)26(22(3)15-20)19-28(32)31(35)33-29-11-13-34-12-7-10-25-17-24(18-27(29)30(25)34)16-23-8-5-4-6-9-23/h4-6,8-9,14-15,17-18,28-29H,7,10-13,16,19,32H2,1-3H3,(H,33,35)/t28-,29+/m0/s1 |
| InChIKey | XKIDSTDHUKMNGG-URLMMPGGSA-N |
| XLogP | 5.09 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |