C29H35N3O — CID 134338649
2-amino-N-[6-[(3-methylphenyl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-3-(2,4,6-trimethylphenyl)propanamide (PubChem CID 134338649) has the molecular formula C29H35N3O and a molecular weight of 441.62 g/mol. Its IUPAC name is 2-amino-N-[6-[(3-methylphenyl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-3-(2,4,6-trimethylphenyl)propanamide.
| Compound Name | 2-amino-N-[6-[(3-methylphenyl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-3-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 134338649 |
| Molecular Formula | C29H35N3O |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | 2-amino-N-[6-[(3-methylphenyl)methyl]-1,2,3,4-tetrahydroquinolin-4-yl]-3-(2,4,6-trimethylphenyl)propanamide |
| SMILES | Cc1cccc(Cc2ccc3c(c2)C(NC(=O)C(N)Cc2c(C)cc(C)cc2C)CCN3)c1 |
| InChI | InChI=1S/C29H35N3O/c1-18-6-5-7-22(14-18)15-23-8-9-27-25(16-23)28(10-11-31-27)32-29(33)26(30)17-24-20(3)12-19(2)13-21(24)4/h5-9,12-14,16,26,28,31H,10-11,15,17,30H2,1-4H3,(H,32,33) |
| InChIKey | BXNWHYDDSTWJIN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |